Initial commit

.obsidian/plugins/chem/data.json

@@ -0,0 +1,29 @@
+{
+  "version": "v3",
+  "darkTheme": "dark",
+  "lightTheme": "light",
+  "sample1": "OC(=O)C(C)=CC1=CC=CC=C1",
+  "sample2": "C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(=CC3)C[C@@H](O)CC4)(CC1)[H])[H])(CC[C@@]2([C@@H](CCCC(C)C)C)[H])[H]",
+  "copy": {
+    "scale": 2,
+    "transparent": true,
+    "theme": "default"
+  },
+  "dataview": false,
+  "inlineSmiles": true,
+  "inlineSmilesPrefix": "$smiles=",
+  "core": "smiles-drawer",
+  "commonOptions": {
+    "width": 300,
+    "scale": 1,
+    "unifiedWidth": 300,
+    "compactDrawing": false,
+    "explicitHydrogens": false,
+    "explicitMethyl": false
+  },
+  "smilesDrawerOptions": {
+    "moleculeOptions": {},
+    "reactionOptions": {}
+  },
+  "rdkitOptions": {}
+}

.obsidian/plugins/chem/manifest.json

@@ -0,0 +1,11 @@
+{
+	"id": "chem",
+	"name": "Chem",
+	"version": "0.4.1",
+	"minAppVersion": "1.0.0",
+	"description": "Providing chemistry supports. Rendering SMILES strings into chemistry structures.",
+	"author": "Acylation",
+	"authorUrl": "https://github.com/Acylation",
+	"fundingUrl": "https://ko-fi.com/Acylation",
+	"isDesktopOnly": false
+}

.obsidian/plugins/chem/styles.css

@@ -0,0 +1,32 @@
+/*
+
+This CSS file will be included with your plugin, and
+available in the app when your plugin is enabled.
+
+If your plugin does not need CSS, delete this file.
+
+*/
+
+.chemcard {
+	background-color: var(--background-secondary-alt);
+	color: var(--color-base-100);
+	border-radius: var(--radius-m);
+	border: 1px solid var(--background-modifier-border);
+	margin: 0 10px;
+	padding: 15px 10px;
+	display: grid;
+	place-content: center;
+	place-items: center;
+	user-select: none;
+}
+
+.chem-table {
+	border-collapse: collapse;
+	display: grid;
+	place-items: center;
+}
+
+.chem-cell {
+	padding: 15px 10px;
+	user-select: none;
+}